C21H20ClN3O2S2 — CID 55997181
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-chlorophenyl)oxane-4-carboxamide (PubChem CID 55997181) has the molecular formula C21H20ClN3O2S2 and a molecular weight of 446.00 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-chlorophenyl)oxane-4-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-chlorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 55997181 |
| Molecular Formula | C21H20ClN3O2S2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-chlorophenyl)oxane-4-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)C1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C21H20ClN3O2S2/c22-17-8-4-7-16(13-17)21(9-11-27-12-10-21)18(26)23-19-24-25-20(29-19)28-14-15-5-2-1-3-6-15/h1-8,13H,9-12,14H2,(H,23,24,26) |
| InChIKey | RNGQEXRMLQHDMU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|