C16H21ClN4OS2 — CID 119264879
1-amino-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119264879) has the molecular formula C16H21ClN4OS2 and a molecular weight of 384.96 g/mol. Its IUPAC name is 1-amino-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119264879 |
| Molecular Formula | C16H21ClN4OS2 |
| Molecular Weight | 384.96 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1-amino-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)Nc2nnc(SCc3ccccc3)s2)CCCCC1 |
| InChI | InChI=1S/C16H20N4OS2.ClH/c17-16(9-5-2-6-10-16)13(21)18-14-19-20-15(23-14)22-11-12-7-3-1-4-8-12;/h1,3-4,7-8H,2,5-6,9-11,17H2,(H,18,19,21);1H |
| InChIKey | DKQNYYDOMNJUND-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.96 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|