C21H21N3O2S2 — CID 83289714
(2R)-N-[5-(3-phenoxypropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 83289714) has the molecular formula C21H21N3O2S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (2R)-N-[5-(3-phenoxypropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | (2R)-N-[5-(3-phenoxypropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 83289714 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2R)-N-[5-(3-phenoxypropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nnc(SCCCOc2ccccc2)s1)C1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21N3O2S2/c25-19(18-14-17(18)15-8-3-1-4-9-15)22-20-23-24-21(28-20)27-13-7-12-26-16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H,22,23,25)/t17-,18?/m0/s1 |
| InChIKey | LZVKGSYXBMLDHH-ZENAZSQFSA-N |
| XLogP | 4.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|