C20H22N4O3S2 — CID 55570782
N-[3-[[5-[3-(4-methoxyphenoxy)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide (PubChem CID 55570782) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is N-[3-[[5-[3-(4-methoxyphenoxy)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-[3-(4-methoxyphenoxy)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 55570782 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[3-[[5-[3-(4-methoxyphenoxy)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide |
| SMILES | COc1ccc(OCCCSc2nnc(Nc3cccc(NC(C)=O)c3)s2)cc1 |
| InChI | InChI=1S/C20H22N4O3S2/c1-14(25)21-15-5-3-6-16(13-15)22-19-23-24-20(29-19)28-12-4-11-27-18-9-7-17(26-2)8-10-18/h3,5-10,13H,4,11-12H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | FHFNMFOOYBWNST-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|