C15H16F3N5O3S2 — CID 56529602
2,2,2-trifluoroethyl N-[2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]carbamate (PubChem CID 56529602) has the molecular formula C15H16F3N5O3S2 and a molecular weight of 435.45 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 56529602 |
| Molecular Formula | C15H16F3N5O3S2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]carbamate |
| SMILES | CC(=O)Nc1cccc(Nc2nnc(SCCNC(=O)OCC(F)(F)F)s2)c1 |
| InChI | InChI=1S/C15H16F3N5O3S2/c1-9(24)20-10-3-2-4-11(7-10)21-12-22-23-14(28-12)27-6-5-19-13(25)26-8-15(16,17)18/h2-4,7H,5-6,8H2,1H3,(H,19,25)(H,20,24)(H,21,22) |
| InChIKey | ZUGAUGLGXCZHJG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|