C14H16F3N3OS2 — CID 112838722
N-(3,4-dimethylphenyl)-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 112838722) has the molecular formula C14H16F3N3OS2 and a molecular weight of 363.43 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3,4-dimethylphenyl)-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 112838722 |
| Molecular Formula | C14H16F3N3OS2 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(3,4-dimethylphenyl)-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1ccc(Nc2nnc(SCCOCC(F)(F)F)s2)cc1C |
| InChI | InChI=1S/C14H16F3N3OS2/c1-9-3-4-11(7-10(9)2)18-12-19-20-13(23-12)22-6-5-21-8-14(15,16)17/h3-4,7H,5-6,8H2,1-2H3,(H,18,19) |
| InChIKey | AOGULQFBLLGEKP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|