C16H18N6O3S2 — CID 55857363
N-[3-[[5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide (PubChem CID 55857363) has the molecular formula C16H18N6O3S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[3-[[5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 55857363 |
| Molecular Formula | C16H18N6O3S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[3-[[5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nnc(SCCCN3C(=O)CNC3=O)s2)c1 |
| InChI | InChI=1S/C16H18N6O3S2/c1-10(23)18-11-4-2-5-12(8-11)19-14-20-21-16(27-14)26-7-3-6-22-13(24)9-17-15(22)25/h2,4-5,8H,3,6-7,9H2,1H3,(H,17,25)(H,18,23)(H,19,20) |
| InChIKey | AMVUFEBMPADAMH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|