C18H23N5O2S2 — CID 55856848
3-[3-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]imidazolidine-2,4-dione (PubChem CID 55856848) has the molecular formula C18H23N5O2S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 3-[3-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55856848 |
| Molecular Formula | C18H23N5O2S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-[3-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
| SMILES | CCc1cccc(CC)c1Nc1nnc(SCCCN2C(=O)CNC2=O)s1 |
| InChI | InChI=1S/C18H23N5O2S2/c1-3-12-7-5-8-13(4-2)15(12)20-16-21-22-18(27-16)26-10-6-9-23-14(24)11-19-17(23)25/h5,7-8H,3-4,6,9-11H2,1-2H3,(H,19,25)(H,20,21) |
| InChIKey | WOTDJNBUBMPWGA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|