C14H13BrN4O2S — CID 99812133
(3R)-1-(3-bromophenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 99812133) has the molecular formula C14H13BrN4O2S and a molecular weight of 381.26 g/mol. Its IUPAC name is (3R)-1-(3-bromophenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-bromophenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 99812133 |
| Molecular Formula | C14H13BrN4O2S |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | (3R)-1-(3-bromophenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1nsc(NC(=O)[C@H]2CCN(c3cccc(Br)c3)C2=O)n1 |
| InChI | InChI=1S/C14H13BrN4O2S/c1-8-16-14(22-18-8)17-12(20)11-5-6-19(13(11)21)10-4-2-3-9(15)7-10/h2-4,7,11H,5-6H2,1H3,(H,16,17,18,20)/t11-/m1/s1 |
| InChIKey | RUHLTDBQZDOKCC-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|