C17H22BrN3O2 — CID 120575887
1-(3-bromophenyl)-N-(2-methylpiperidin-3-yl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 120575887) has the molecular formula C17H22BrN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(2-methylpiperidin-3-yl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-(2-methylpiperidin-3-yl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120575887 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-(3-bromophenyl)-N-(2-methylpiperidin-3-yl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC1NCCCC1NC(=O)C1CCN(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C17H22BrN3O2/c1-11-15(6-3-8-19-11)20-16(22)14-7-9-21(17(14)23)13-5-2-4-12(18)10-13/h2,4-5,10-11,14-15,19H,3,6-9H2,1H3,(H,20,22) |
| InChIKey | SBTKSNKPKBGVAB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|