C16H20BrN3O2 — CID 119415517
1-(3-bromophenyl)-3-(1,4-diazepane-1-carbonyl)pyrrolidin-2-one (PubChem CID 119415517) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(1,4-diazepane-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(3-bromophenyl)-3-(1,4-diazepane-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 119415517 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-(3-bromophenyl)-3-(1,4-diazepane-1-carbonyl)pyrrolidin-2-one |
| SMILES | O=C(C1CCN(c2cccc(Br)c2)C1=O)N1CCCNCC1 |
| InChI | InChI=1S/C16H20BrN3O2/c17-12-3-1-4-13(11-12)20-9-5-14(16(20)22)15(21)19-8-2-6-18-7-10-19/h1,3-4,11,14,18H,2,5-10H2 |
| InChIKey | DAIJHZKJHUBHSN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|