C16H20BrN3O2 — CID 124611408
(3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3-bromophenyl)pyrrolidin-2-one (PubChem CID 124611408) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is (3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3-bromophenyl)pyrrolidin-2-one.
| Compound Name | (3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3-bromophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 124611408 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3-bromophenyl)pyrrolidin-2-one |
| SMILES | NC[C@H]1CCN(C(=O)[C@@H]2CCN(c3cccc(Br)c3)C2=O)C1 |
| InChI | InChI=1S/C16H20BrN3O2/c17-12-2-1-3-13(8-12)20-7-5-14(16(20)22)15(21)19-6-4-11(9-18)10-19/h1-3,8,11,14H,4-7,9-10,18H2/t11-,14+/m1/s1 |
| InChIKey | RVSGEAVXTGWZPR-RISCZKNCSA-N |
| XLogP | 1.61 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|