C16H17BrN2O4 — CID 119372061
(2R)-1-[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 119372061) has the molecular formula C16H17BrN2O4 and a molecular weight of 381.23 g/mol. Its IUPAC name is (2R)-1-[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119372061 |
| Molecular Formula | C16H17BrN2O4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (2R)-1-[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)C1CCN(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C16H17BrN2O4/c17-10-3-1-4-11(9-10)18-8-6-12(14(18)20)15(21)19-7-2-5-13(19)16(22)23/h1,3-4,9,12-13H,2,5-8H2,(H,22,23)/t12?,13-/m1/s1 |
| InChIKey | FEIQMCBJNZOKHR-ZGTCLIOFSA-N |
| XLogP | 1.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|