C16H16Cl2N2O4 — CID 99701726
(2S)-1-[(3S)-1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 99701726) has the molecular formula C16H16Cl2N2O4 and a molecular weight of 371.22 g/mol. Its IUPAC name is (2S)-1-[(3S)-1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(3S)-1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 99701726 |
| Molecular Formula | C16H16Cl2N2O4 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (2S)-1-[(3S)-1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)[C@@H]1CCN(c2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C16H16Cl2N2O4/c17-9-6-10(18)8-11(7-9)19-5-3-12(14(19)21)15(22)20-4-1-2-13(20)16(23)24/h6-8,12-13H,1-5H2,(H,23,24)/t12-,13+/m1/s1 |
| InChIKey | NEMJUNTZXNTOTF-OLZOCXBDSA-N |
| XLogP | 2.42 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|