C16H20Cl3N3O2 — CID 119631172
3-[2-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,4-dichlorophenyl)pyrrolidin-2-one;hydrochloride (PubChem CID 119631172) has the molecular formula C16H20Cl3N3O2 and a molecular weight of 392.71 g/mol. Its IUPAC name is 3-[2-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,4-dichlorophenyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 3-[2-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,4-dichlorophenyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119631172 |
| Molecular Formula | C16H20Cl3N3O2 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 3-[2-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,4-dichlorophenyl)pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.NCC1CCCN1C(=O)C1CCN(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C16H19Cl2N3O2.ClH/c17-13-4-3-10(8-14(13)18)21-7-5-12(16(21)23)15(22)20-6-1-2-11(20)9-19;/h3-4,8,11-12H,1-2,5-7,9,19H2;1H |
| InChIKey | USPDIHMTFVDYDF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|