C16H19Cl2N3O2 — CID 119386103
1-(3,4-dichlorophenyl)-2-oxo-N-piperidin-4-ylpyrrolidine-3-carboxamide (PubChem CID 119386103) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-oxo-N-piperidin-4-ylpyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-2-oxo-N-piperidin-4-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119386103 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-oxo-N-piperidin-4-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)C1CCN(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-13-2-1-11(9-14(13)18)21-8-5-12(16(21)23)15(22)20-10-3-6-19-7-4-10/h1-2,9-10,12,19H,3-8H2,(H,20,22) |
| InChIKey | RNMMCBCVPVHSJT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|