C17H24Cl2N4O — CID 167917066
N-(azepan-4-yl)-4-(3,4-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 167917066) has the molecular formula C17H24Cl2N4O and a molecular weight of 371.31 g/mol. Its IUPAC name is N-(azepan-4-yl)-4-(3,4-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | N-(azepan-4-yl)-4-(3,4-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 167917066 |
| Molecular Formula | C17H24Cl2N4O |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(azepan-4-yl)-4-(3,4-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CCCNCC1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H24Cl2N4O/c18-15-4-3-14(12-16(15)19)22-8-10-23(11-9-22)17(24)21-13-2-1-6-20-7-5-13/h3-4,12-13,20H,1-2,5-11H2,(H,21,24) |
| InChIKey | YDXUEVSUKQUDKI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |