C19H29ClN4O4 — CID 19602687
methyl 2-[4-[4-(piperidin-4-ylcarbamoyl)piperazin-1-yl]phenoxy]acetate;hydrochloride (PubChem CID 19602687) has the molecular formula C19H29ClN4O4 and a molecular weight of 412.92 g/mol. Its IUPAC name is methyl 2-[4-[4-(piperidin-4-ylcarbamoyl)piperazin-1-yl]phenoxy]acetate;hydrochloride.
| Compound Name | methyl 2-[4-[4-(piperidin-4-ylcarbamoyl)piperazin-1-yl]phenoxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 19602687 |
| Molecular Formula | C19H29ClN4O4 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | methyl 2-[4-[4-(piperidin-4-ylcarbamoyl)piperazin-1-yl]phenoxy]acetate;hydrochloride |
| SMILES | COC(=O)COc1ccc(N2CCN(C(=O)NC3CCNCC3)CC2)cc1.Cl |
| InChI | InChI=1S/C19H28N4O4.ClH/c1-26-18(24)14-27-17-4-2-16(3-5-17)22-10-12-23(13-11-22)19(25)21-15-6-8-20-9-7-15;/h2-5,15,20H,6-14H2,1H3,(H,21,25);1H |
| InChIKey | PWVBFZHGZMXUMI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|