C16H21Cl2N3O3S — CID 27534567
N-cyclopentyl-4-(3,4-dichlorophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 27534567) has the molecular formula C16H21Cl2N3O3S and a molecular weight of 406.34 g/mol. Its IUPAC name is N-cyclopentyl-4-(3,4-dichlorophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-cyclopentyl-4-(3,4-dichlorophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 27534567 |
| Molecular Formula | C16H21Cl2N3O3S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-cyclopentyl-4-(3,4-dichlorophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O3S/c17-14-6-5-13(11-15(14)18)25(23,24)21-9-7-20(8-10-21)16(22)19-12-3-1-2-4-12/h5-6,11-12H,1-4,7-10H2,(H,19,22) |
| InChIKey | ZYTYHBFPYAWLQY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |