C19H27N3O5S — CID 35398766
methyl 3-[4-(cyclohexylcarbamoyl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 35398766) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is methyl 3-[4-(cyclohexylcarbamoyl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 3-[4-(cyclohexylcarbamoyl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 35398766 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | methyl 3-[4-(cyclohexylcarbamoyl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N2CCN(C(=O)NC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C19H27N3O5S/c1-27-18(23)15-6-5-9-17(14-15)28(25,26)22-12-10-21(11-13-22)19(24)20-16-7-3-2-4-8-16/h5-6,9,14,16H,2-4,7-8,10-13H2,1H3,(H,20,24) |
| InChIKey | GQIQYWAIEPKFJM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |