C19H25ClN2O2 — CID 94079940
(3S)-1-(4-chlorophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 94079940) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94079940 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)[C@@H]1CCN(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C19H25ClN2O2/c20-14-8-10-16(11-9-14)22-13-12-17(19(22)24)18(23)21-15-6-4-2-1-3-5-7-15/h8-11,15,17H,1-7,12-13H2,(H,21,23)/t17-/m0/s1 |
| InChIKey | CDVCCOARNKSSCH-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|