C13H15ClN2O3 — CID 94211690
(3S)-1-(4-chlorophenyl)-N-ethoxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 94211690) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-N-ethoxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorophenyl)-N-ethoxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94211690 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-N-ethoxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCONC(=O)[C@H]1CCN(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C13H15ClN2O3/c1-2-19-15-12(17)11-7-8-16(13(11)18)10-5-3-9(14)4-6-10/h3-6,11H,2,7-8H2,1H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | MGXXPTMKPPUDKM-LLVKDONJSA-N |
| XLogP | 1.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|