C17H23ClN2O3 — CID 111483766
1-(4-chlorophenyl)-N-(2-hydroxy-2,3-dimethylbutyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 111483766) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2-hydroxy-2,3-dimethylbutyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(2-hydroxy-2,3-dimethylbutyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 111483766 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2-hydroxy-2,3-dimethylbutyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC(C)C(C)(O)CNC(=O)C1CCN(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(2)17(3,23)10-19-15(21)14-8-9-20(16(14)22)13-6-4-12(18)5-7-13/h4-7,11,14,23H,8-10H2,1-3H3,(H,19,21) |
| InChIKey | IIGXCKMMHOSSOF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|