C19H25BrN2O2 — CID 71893622
1-(2-bromophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 71893622) has the molecular formula C19H25BrN2O2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-bromophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71893622 |
| Molecular Formula | C19H25BrN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-(2-bromophenyl)-N-cyclooctyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)C1CCN(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C19H25BrN2O2/c20-16-10-6-7-11-17(16)22-13-12-15(19(22)24)18(23)21-14-8-4-2-1-3-5-9-14/h6-7,10-11,14-15H,1-5,8-9,12-13H2,(H,21,23) |
| InChIKey | XUZZEOMYRDCSBU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|