C16H19BrN2O4 — CID 119368549
(2R)-2-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 119368549) has the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. Its IUPAC name is (2R)-2-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119368549 |
| Molecular Formula | C16H19BrN2O4 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | (2R)-2-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)C1CCN(c2ccccc2Br)C1=O)C(=O)O |
| InChI | InChI=1S/C16H19BrN2O4/c1-9(2)13(16(22)23)18-14(20)10-7-8-19(15(10)21)12-6-4-3-5-11(12)17/h3-6,9-10,13H,7-8H2,1-2H3,(H,18,20)(H,22,23)/t10?,13-/m1/s1 |
| InChIKey | XGSYDMHFCVLONJ-JLOHTSLTSA-N |
| XLogP | 2.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|