C15H17BrN2O4 — CID 125120843
(2R)-2-[[(3R)-1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid (PubChem CID 125120843) has the molecular formula C15H17BrN2O4 and a molecular weight of 369.22 g/mol. Its IUPAC name is (2R)-2-[[(3R)-1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid.
| Compound Name | (2R)-2-[[(3R)-1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 125120843 |
| Molecular Formula | C15H17BrN2O4 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (2R)-2-[[(3R)-1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
| SMILES | C[C@H](C(=O)O)N(C)C(=O)[C@H]1CCN(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C15H17BrN2O4/c1-9(15(21)22)17(2)13(19)10-7-8-18(14(10)20)12-6-4-3-5-11(12)16/h3-6,9-10H,7-8H2,1-2H3,(H,21,22)/t9-,10-/m1/s1 |
| InChIKey | AZGGCEYRUOKNIV-NXEZZACHSA-N |
| XLogP | 1.73 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|