C16H21BrN2O3S — CID 75455510
1-(2-bromophenyl)-N-methyl-N-(1-methylsulfinylpropan-2-yl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 75455510) has the molecular formula C16H21BrN2O3S and a molecular weight of 401.33 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-methyl-N-(1-methylsulfinylpropan-2-yl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-bromophenyl)-N-methyl-N-(1-methylsulfinylpropan-2-yl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75455510 |
| Molecular Formula | C16H21BrN2O3S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-(2-bromophenyl)-N-methyl-N-(1-methylsulfinylpropan-2-yl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC(CS(C)=O)N(C)C(=O)C1CCN(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C16H21BrN2O3S/c1-11(10-23(3)22)18(2)15(20)12-8-9-19(16(12)21)14-7-5-4-6-13(14)17/h4-7,11-12H,8-10H2,1-3H3 |
| InChIKey | PDRHAWRPNVKJQE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|