C14H15BrN2O4 — CID 119177355
3-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]propanoic acid (PubChem CID 119177355) has the molecular formula C14H15BrN2O4 and a molecular weight of 355.19 g/mol. Its IUPAC name is 3-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119177355 |
| Molecular Formula | C14H15BrN2O4 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 3-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C1CCN(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C14H15BrN2O4/c15-10-3-1-2-4-11(10)17-8-6-9(14(17)21)13(20)16-7-5-12(18)19/h1-4,9H,5-8H2,(H,16,20)(H,18,19) |
| InChIKey | QZVPZBPOFFYESP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|