C21H18BrN3O3 — CID 97016489
(3S)-1-(2-bromophenyl)-2-oxo-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]pyrrolidine-3-carboxamide (PubChem CID 97016489) has the molecular formula C21H18BrN3O3 and a molecular weight of 440.30 g/mol. Its IUPAC name is (3S)-1-(2-bromophenyl)-2-oxo-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(2-bromophenyl)-2-oxo-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97016489 |
| Molecular Formula | C21H18BrN3O3 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | (3S)-1-(2-bromophenyl)-2-oxo-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ncc(-c2ccccc2)o1)[C@@H]1CCN(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C21H18BrN3O3/c22-16-8-4-5-9-17(16)25-11-10-15(21(25)27)20(26)24-13-19-23-12-18(28-19)14-6-2-1-3-7-14/h1-9,12,15H,10-11,13H2,(H,24,26)/t15-/m0/s1 |
| InChIKey | YDYNAXIQZRYHIC-HNNXBMFYSA-N |
| XLogP | 3.77 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|