C24H23BrN4O2 — CID 112834583
1-(2-bromophenyl)-2-oxo-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 112834583) has the molecular formula C24H23BrN4O2 and a molecular weight of 479.38 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-oxo-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-bromophenyl)-2-oxo-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 112834583 |
| Molecular Formula | C24H23BrN4O2 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-(2-bromophenyl)-2-oxo-N-[4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ncc3n2CCCC3)cc1)C1CCN(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C24H23BrN4O2/c25-20-6-1-2-7-21(20)29-14-12-19(24(29)31)23(30)27-17-10-8-16(9-11-17)22-26-15-18-5-3-4-13-28(18)22/h1-2,6-11,15,19H,3-5,12-14H2,(H,27,30) |
| InChIKey | RXHKITVSCQVITB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|