C16H16BrN5O3 — CID 56571589
4-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 56571589) has the molecular formula C16H16BrN5O3 and a molecular weight of 406.24 g/mol. Its IUPAC name is 4-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56571589 |
| Molecular Formula | C16H16BrN5O3 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 4-[[1-(2-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(N)=O)c1NC(=O)C1CCN(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C16H16BrN5O3/c1-8-12(13(14(18)23)21-20-8)19-15(24)9-6-7-22(16(9)25)11-5-3-2-4-10(11)17/h2-5,9H,6-7H2,1H3,(H2,18,23)(H,19,24)(H,20,21) |
| InChIKey | RBRYDMKSQLLHPU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|