C17H16Cl2F3N3O3 — CID 86938913
1-(3,4-dichlorophenyl)-2-oxo-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyrrolidine-3-carboxamide (PubChem CID 86938913) has the molecular formula C17H16Cl2F3N3O3 and a molecular weight of 438.23 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-oxo-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-2-oxo-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86938913 |
| Molecular Formula | C17H16Cl2F3N3O3 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-oxo-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCN(CC(F)(F)F)C1=O)C1CCN(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H16Cl2F3N3O3/c18-11-2-1-9(7-12(11)19)25-6-3-10(15(25)27)14(26)23-13-4-5-24(16(13)28)8-17(20,21)22/h1-2,7,10,13H,3-6,8H2,(H,23,26) |
| InChIKey | UOBOTOYSTSULAL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|