C16H13ClF6N2O2 — CID 126797860
3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]prop-2-enamide (PubChem CID 126797860) has the molecular formula C16H13ClF6N2O2 and a molecular weight of 414.73 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126797860 |
| Molecular Formula | C16H13ClF6N2O2 |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(C(F)(F)F)c1)NC1CCN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C16H13ClF6N2O2/c17-11-3-1-9(7-10(11)16(21,22)23)2-4-13(26)24-12-5-6-25(14(12)27)8-15(18,19)20/h1-4,7,12H,5-6,8H2,(H,24,26) |
| InChIKey | LIRNICNSKAJZSM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|