C21H28Cl2N4O2 — CID 86896761
1-(3,4-dichlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)pyrrolidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 86896761) has the molecular formula C21H28Cl2N4O2 and a molecular weight of 439.39 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)pyrrolidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)pyrrolidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 86896761 |
| Molecular Formula | C21H28Cl2N4O2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)pyrrolidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CCN1CCN(C2CCN(C(=O)C3CCN(c4ccc(Cl)c(Cl)c4)C3=O)C2)CC1 |
| InChI | InChI=1S/C21H28Cl2N4O2/c1-2-24-9-11-25(12-10-24)16-5-7-26(14-16)20(28)17-6-8-27(21(17)29)15-3-4-18(22)19(23)13-15/h3-4,13,16-17H,2,5-12,14H2,1H3 |
| InChIKey | GMHGFEHMWDCJJH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|