C17H23N3O2 — CID 124695032
(3R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(3,4-dimethylphenyl)pyrrolidin-2-one (PubChem CID 124695032) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(3,4-dimethylphenyl)pyrrolidin-2-one.
| Compound Name | (3R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(3,4-dimethylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 124695032 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(3,4-dimethylphenyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(N2CC[C@H](C(=O)N3CC[C@@H](N)C3)C2=O)cc1C |
| InChI | InChI=1S/C17H23N3O2/c1-11-3-4-14(9-12(11)2)20-8-6-15(17(20)22)16(21)19-7-5-13(18)10-19/h3-4,9,13,15H,5-8,10,18H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | IDJSXWFWTMXWCM-UKRRQHHQSA-N |
| XLogP | 1.22 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|