C20H26N2O4 — CID 124694731
3-[(3S)-1-[(3S)-1-(4-methylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidin-3-yl]propanoic acid (PubChem CID 124694731) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-[(3S)-1-[(3S)-1-(4-methylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S)-1-[(3S)-1-(4-methylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124694731 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-[(3S)-1-[(3S)-1-(4-methylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidin-3-yl]propanoic acid |
| SMILES | Cc1ccc(N2CC[C@@H](C(=O)N3CCC[C@@H](CCC(=O)O)C3)C2=O)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-14-4-7-16(8-5-14)22-12-10-17(20(22)26)19(25)21-11-2-3-15(13-21)6-9-18(23)24/h4-5,7-8,15,17H,2-3,6,9-13H2,1H3,(H,23,24)/t15-,17-/m0/s1 |
| InChIKey | XNUKPZXWQPSFCO-RDJZCZTQSA-N |
| XLogP | 2.45 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|