C17H21ClN2O3 — CID 110903002
1-(4-chlorophenyl)-3-[3-(hydroxymethyl)piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 110903002) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(hydroxymethyl)piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(hydroxymethyl)piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110903002 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(hydroxymethyl)piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C(C1CCN(c2ccc(Cl)cc2)C1=O)N1CCCC(CO)C1 |
| InChI | InChI=1S/C17H21ClN2O3/c18-13-3-5-14(6-4-13)20-9-7-15(17(20)23)16(22)19-8-1-2-12(10-19)11-21/h3-6,12,15,21H,1-2,7-11H2 |
| InChIKey | NEAMJYIJAJDZCR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|