C20H22N4O3 — CID 94477713
(3R)-N-[3-(carbamoylamino)phenyl]-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 94477713) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (3R)-N-[3-(carbamoylamino)phenyl]-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(carbamoylamino)phenyl]-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94477713 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (3R)-N-[3-(carbamoylamino)phenyl]-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC[C@H](C(=O)Nc3cccc(NC(N)=O)c3)C2=O)cc1C |
| InChI | InChI=1S/C20H22N4O3/c1-12-6-7-16(10-13(12)2)24-9-8-17(19(24)26)18(25)22-14-4-3-5-15(11-14)23-20(21)27/h3-7,10-11,17H,8-9H2,1-2H3,(H,22,25)(H3,21,23,27)/t17-/m1/s1 |
| InChIKey | DCLITLDQRUMZOC-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|