C17H22N2O4 — CID 124698156
4-[[(3R)-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]amino]butanoic acid (PubChem CID 124698156) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-[[(3R)-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[(3R)-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 124698156 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-[[(3R)-1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccc(N2CC[C@H](C(=O)NCCCC(=O)O)C2=O)cc1C |
| InChI | InChI=1S/C17H22N2O4/c1-11-5-6-13(10-12(11)2)19-9-7-14(17(19)23)16(22)18-8-3-4-15(20)21/h5-6,10,14H,3-4,7-9H2,1-2H3,(H,18,22)(H,20,21)/t14-/m1/s1 |
| InChIKey | SXQACMZFJJYHGC-CQSZACIVSA-N |
| XLogP | 1.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|