C18H24N2O2 — CID 95049411
(3R)-N-(cyclopropylmethyl)-1-(3,4-dimethylphenyl)-N-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 95049411) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3R)-N-(cyclopropylmethyl)-1-(3,4-dimethylphenyl)-N-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(cyclopropylmethyl)-1-(3,4-dimethylphenyl)-N-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95049411 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3R)-N-(cyclopropylmethyl)-1-(3,4-dimethylphenyl)-N-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC[C@H](C(=O)N(C)CC3CC3)C2=O)cc1C |
| InChI | InChI=1S/C18H24N2O2/c1-12-4-7-15(10-13(12)2)20-9-8-16(18(20)22)17(21)19(3)11-14-5-6-14/h4,7,10,14,16H,5-6,8-9,11H2,1-3H3/t16-/m1/s1 |
| InChIKey | UILCDVKXBAJQJN-MRXNPFEDSA-N |
| XLogP | 2.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|