C15H16F2N2O4 — CID 125154283
3-[[(3S)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid (PubChem CID 125154283) has the molecular formula C15H16F2N2O4 and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-[[(3S)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid.
| Compound Name | 3-[[(3S)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 125154283 |
| Molecular Formula | C15H16F2N2O4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-[[(3S)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)[C@@H]1CCN(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C15H16F2N2O4/c1-18(6-5-13(20)21)14(22)10-4-7-19(15(10)23)9-2-3-11(16)12(17)8-9/h2-3,8,10H,4-7H2,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | ZBDSZIIZKCRGHM-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|