C19H18F2N2O2S — CID 95185961
(3S)-N-cyclopropyl-1-(3,4-difluorophenyl)-2-oxo-N-(thiophen-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 95185961) has the molecular formula C19H18F2N2O2S and a molecular weight of 376.43 g/mol. Its IUPAC name is (3S)-N-cyclopropyl-1-(3,4-difluorophenyl)-2-oxo-N-(thiophen-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-cyclopropyl-1-(3,4-difluorophenyl)-2-oxo-N-(thiophen-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95185961 |
| Molecular Formula | C19H18F2N2O2S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (3S)-N-cyclopropyl-1-(3,4-difluorophenyl)-2-oxo-N-(thiophen-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C1[C@H](C(=O)N(Cc2ccsc2)C2CC2)CCN1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H18F2N2O2S/c20-16-4-3-14(9-17(16)21)22-7-5-15(18(22)24)19(25)23(13-1-2-13)10-12-6-8-26-11-12/h3-4,6,8-9,11,13,15H,1-2,5,7,10H2/t15-/m1/s1 |
| InChIKey | MPVJQKOFVZHLLA-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|