C21H20BrFN2O2 — CID 55870489
1-(3-bromophenyl)-N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 55870489) has the molecular formula C21H20BrFN2O2 and a molecular weight of 431.31 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55870489 |
| Molecular Formula | C21H20BrFN2O2 |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-(3-bromophenyl)-N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1C(C(=O)N(Cc2cccc(F)c2)C2CC2)CCN1c1cccc(Br)c1 |
| InChI | InChI=1S/C21H20BrFN2O2/c22-15-4-2-6-18(12-15)24-10-9-19(20(24)26)21(27)25(17-7-8-17)13-14-3-1-5-16(23)11-14/h1-6,11-12,17,19H,7-10,13H2 |
| InChIKey | IQVUMOWTRKASNK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|