C16H20N2O4 — CID 119346411
2-[[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid (PubChem CID 119346411) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid.
| Compound Name | 2-[[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 119346411 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid |
| SMILES | Cc1cc(C)cc(N2CCC(C(=O)N(C)CC(=O)O)C2=O)c1 |
| InChI | InChI=1S/C16H20N2O4/c1-10-6-11(2)8-12(7-10)18-5-4-13(16(18)22)15(21)17(3)9-14(19)20/h6-8,13H,4-5,9H2,1-3H3,(H,19,20) |
| InChIKey | VHBQMVLAEFWBQL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|