C15H16Cl2N2O4 — CID 136516200
3-[[1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid (PubChem CID 136516200) has the molecular formula C15H16Cl2N2O4 and a molecular weight of 359.21 g/mol. Its IUPAC name is 3-[[1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid.
| Compound Name | 3-[[1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 136516200 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-[[1-(3,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)C1CCN(c2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C15H16Cl2N2O4/c1-18(4-3-13(20)21)14(22)12-2-5-19(15(12)23)11-7-9(16)6-10(17)8-11/h6-8,12H,2-5H2,1H3,(H,20,21) |
| InChIKey | ZKDGVONKANWAQR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|