C14H14Cl2N2O4 — CID 119171907
2-[[1-(2,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid (PubChem CID 119171907) has the molecular formula C14H14Cl2N2O4 and a molecular weight of 345.18 g/mol. Its IUPAC name is 2-[[1-(2,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid.
| Compound Name | 2-[[1-(2,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 119171907 |
| Molecular Formula | C14H14Cl2N2O4 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-[[1-(2,5-dichlorophenyl)-2-oxopyrrolidine-3-carbonyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)C1CCN(c2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C14H14Cl2N2O4/c1-17(7-12(19)20)13(21)9-4-5-18(14(9)22)11-6-8(15)2-3-10(11)16/h2-3,6,9H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | AGTWDOFJDWCFEL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|