C16H19ClN2O3 — CID 42863491
1-(4-chloro-3-methylphenyl)-3-(morpholine-4-carbonyl)pyrrolidin-2-one (PubChem CID 42863491) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3-(morpholine-4-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3-(morpholine-4-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 42863491 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3-(morpholine-4-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1cc(N2CCC(C(=O)N3CCOCC3)C2=O)ccc1Cl |
| InChI | InChI=1S/C16H19ClN2O3/c1-11-10-12(2-3-14(11)17)19-5-4-13(16(19)21)15(20)18-6-8-22-9-7-18/h2-3,10,13H,4-9H2,1H3 |
| InChIKey | YUFLPGPKUKVMHW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|