C23H33N3O3 — CID 166193469
1-(3,5-dimethylphenyl)-3-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 166193469) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 166193469 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | Cc1cc(C)cc(N2CCC(C(=O)N3CCC(CN4CCOCC4)CC3)C2=O)c1 |
| InChI | InChI=1S/C23H33N3O3/c1-17-13-18(2)15-20(14-17)26-8-5-21(23(26)28)22(27)25-6-3-19(4-7-25)16-24-9-11-29-12-10-24/h13-15,19,21H,3-12,16H2,1-2H3 |
| InChIKey | QPEOSSCJWPBYIW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|