C21H30N4O3 — CID 119481119
N-(2-aminoethyl)-1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxamide (PubChem CID 119481119) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119481119 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-(2-aminoethyl)-1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(N2CCC(C(=O)N3CCCC(C(=O)NCCN)C3)C2=O)c1 |
| InChI | InChI=1S/C21H30N4O3/c1-14-10-15(2)12-17(11-14)25-9-5-18(21(25)28)20(27)24-8-3-4-16(13-24)19(26)23-7-6-22/h10-12,16,18H,3-9,13,22H2,1-2H3,(H,23,26) |
| InChIKey | DPMRGMCNGFNYAG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|