C18H25N3O2 — CID 99602181
(3R)-1-(3,5-dimethylphenyl)-2-oxo-N-piperidin-1-ylpyrrolidine-3-carboxamide (PubChem CID 99602181) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (3R)-1-(3,5-dimethylphenyl)-2-oxo-N-piperidin-1-ylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3,5-dimethylphenyl)-2-oxo-N-piperidin-1-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 99602181 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (3R)-1-(3,5-dimethylphenyl)-2-oxo-N-piperidin-1-ylpyrrolidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(N2CC[C@@H](C(=O)NN3CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-13-10-14(2)12-15(11-13)21-9-6-16(18(21)23)17(22)19-20-7-4-3-5-8-20/h10-12,16H,3-9H2,1-2H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | BYKCXEHFCGMCQX-INIZCTEOSA-N |
| XLogP | 2.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|